C20H29N3OS2 — CID 155693550
5-amino-2-(2-cyclohexyl-1,3-thiazol-5-yl)-N-ethyl-N-propylbenzenesulfinamide (PubChem CID 155693550) has the molecular formula C20H29N3OS2 and a molecular weight of 391.61 g/mol. Its IUPAC name is 5-amino-2-(2-cyclohexyl-1,3-thiazol-5-yl)-N-ethyl-N-propylbenzenesulfinamide.
| Compound Name | 5-amino-2-(2-cyclohexyl-1,3-thiazol-5-yl)-N-ethyl-N-propylbenzenesulfinamide |
|---|---|
| PubChem CID | 155693550 |
| Molecular Formula | C20H29N3OS2 |
| Molecular Weight | 391.61 g/mol |
| Exact Mass | 391.18 |
| IUPAC Name | 5-amino-2-(2-cyclohexyl-1,3-thiazol-5-yl)-N-ethyl-N-propylbenzenesulfinamide |
| SMILES | CCCN(CC)S(=O)c1cc(N)ccc1-c1cnc(C2CCCCC2)s1 |
| InChI | InChI=1S/C20H29N3OS2/c1-3-12-23(4-2)26(24)19-13-16(21)10-11-17(19)18-14-22-20(25-18)15-8-6-5-7-9-15/h10-11,13-15H,3-9,12,21H2,1-2H3 |
| InChIKey | JOEWZPPGUVNUTQ-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.61 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|