C19H14F4N2O3S — CID 69159158
2-[(4-fluorophenyl)methoxy]-4-(4-methylsulfonylphenyl)-5-(trifluoromethyl)pyrimidine (PubChem CID 69159158) has the molecular formula C19H14F4N2O3S and a molecular weight of 426.39 g/mol. Its IUPAC name is 2-[(4-fluorophenyl)methoxy]-4-(4-methylsulfonylphenyl)-5-(trifluoromethyl)pyrimidine.
| Compound Name | 2-[(4-fluorophenyl)methoxy]-4-(4-methylsulfonylphenyl)-5-(trifluoromethyl)pyrimidine |
|---|---|
| PubChem CID | 69159158 |
| Molecular Formula | C19H14F4N2O3S |
| Molecular Weight | 426.39 g/mol |
| Exact Mass | 426.07 |
| IUPAC Name | 2-[(4-fluorophenyl)methoxy]-4-(4-methylsulfonylphenyl)-5-(trifluoromethyl)pyrimidine |
| SMILES | CS(=O)(=O)c1ccc(-c2nc(OCc3ccc(F)cc3)ncc2C(F)(F)F)cc1 |
| InChI | InChI=1S/C19H14F4N2O3S/c1-29(26,27)15-8-4-13(5-9-15)17-16(19(21,22)23)10-24-18(25-17)28-11-12-2-6-14(20)7-3-12/h2-10H,11H2,1H3 |
| InChIKey | NSHJTLUNRASPQA-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 69.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.39 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |