C14H15F2N3O3S — CID 59160578
N-[5-fluoro-2-[(4-fluorophenyl)methoxy]pyrimidin-4-yl]propane-2-sulfonamide (PubChem CID 59160578) has the molecular formula C14H15F2N3O3S and a molecular weight of 343.36 g/mol. Its IUPAC name is N-[5-fluoro-2-[(4-fluorophenyl)methoxy]pyrimidin-4-yl]propane-2-sulfonamide.
| Compound Name | N-[5-fluoro-2-[(4-fluorophenyl)methoxy]pyrimidin-4-yl]propane-2-sulfonamide |
|---|---|
| PubChem CID | 59160578 |
| Molecular Formula | C14H15F2N3O3S |
| Molecular Weight | 343.36 g/mol |
| Exact Mass | 343.08 |
| IUPAC Name | N-[5-fluoro-2-[(4-fluorophenyl)methoxy]pyrimidin-4-yl]propane-2-sulfonamide |
| SMILES | CC(C)S(=O)(=O)Nc1nc(OCc2ccc(F)cc2)ncc1F |
| InChI | InChI=1S/C14H15F2N3O3S/c1-9(2)23(20,21)19-13-12(16)7-17-14(18-13)22-8-10-3-5-11(15)6-4-10/h3-7,9H,8H2,1-2H3,(H,17,18,19) |
| InChIKey | LKRJENBOOLCAOF-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.36 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |