C16H20F2N4O2 — CID 143838946
N-[[5-fluoro-2-[(4-fluorophenyl)methoxy]pyrimidin-4-yl]amino]formamide;2-methylpropane (PubChem CID 143838946) has the molecular formula C16H20F2N4O2 and a molecular weight of 338.36 g/mol. Its IUPAC name is N-[[5-fluoro-2-[(4-fluorophenyl)methoxy]pyrimidin-4-yl]amino]formamide;2-methylpropane.
| Compound Name | N-[[5-fluoro-2-[(4-fluorophenyl)methoxy]pyrimidin-4-yl]amino]formamide;2-methylpropane |
|---|---|
| PubChem CID | 143838946 |
| Molecular Formula | C16H20F2N4O2 |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | N-[[5-fluoro-2-[(4-fluorophenyl)methoxy]pyrimidin-4-yl]amino]formamide;2-methylpropane |
| SMILES | CC(C)C.O=CNNc1nc(OCc2ccc(F)cc2)ncc1F |
| InChI | InChI=1S/C12H10F2N4O2.C4H10/c13-9-3-1-8(2-4-9)6-20-12-15-5-10(14)11(17-12)18-16-7-19;1-4(2)3/h1-5,7H,6H2,(H,16,19)(H,15,17,18);4H,1-3H3 |
| InChIKey | MIMYILQVVPCGSL-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|