C17H14F2N4O3S — CID 148602267
2-[[5-fluoro-2-[(4-fluorophenyl)methoxy]pyrimidin-4-yl]amino]sulfanyl-N-hydroxybenzeneamine oxide (PubChem CID 148602267) has the molecular formula C17H14F2N4O3S and a molecular weight of 392.39 g/mol. Its IUPAC name is 2-[[5-fluoro-2-[(4-fluorophenyl)methoxy]pyrimidin-4-yl]amino]sulfanyl-N-hydroxybenzeneamine oxide.
| Compound Name | 2-[[5-fluoro-2-[(4-fluorophenyl)methoxy]pyrimidin-4-yl]amino]sulfanyl-N-hydroxybenzeneamine oxide |
|---|---|
| PubChem CID | 148602267 |
| Molecular Formula | C17H14F2N4O3S |
| Molecular Weight | 392.39 g/mol |
| Exact Mass | 392.08 |
| IUPAC Name | 2-[[5-fluoro-2-[(4-fluorophenyl)methoxy]pyrimidin-4-yl]amino]sulfanyl-N-hydroxybenzeneamine oxide |
| SMILES | [O-][NH+](O)c1ccccc1SNc1nc(OCc2ccc(F)cc2)ncc1F |
| InChI | InChI=1S/C17H14F2N4O3S/c18-12-7-5-11(6-8-12)10-26-17-20-9-13(19)16(21-17)22-27-15-4-2-1-3-14(15)23(24)25/h1-9,23-24H,10H2,(H,20,21,22) |
| InChIKey | NCSVCEFFGRICAO-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 94.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.39 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|