C11H10F2N3O4P — CID 151140451
[5-fluoro-2-[(4-fluorophenyl)methoxy]pyrimidin-4-yl]oxyphosphonamidic acid (PubChem CID 151140451) has the molecular formula C11H10F2N3O4P and a molecular weight of 317.19 g/mol. Its IUPAC name is [5-fluoro-2-[(4-fluorophenyl)methoxy]pyrimidin-4-yl]oxyphosphonamidic acid.
| Compound Name | [5-fluoro-2-[(4-fluorophenyl)methoxy]pyrimidin-4-yl]oxyphosphonamidic acid |
|---|---|
| PubChem CID | 151140451 |
| Molecular Formula | C11H10F2N3O4P |
| Molecular Weight | 317.19 g/mol |
| Exact Mass | 317.04 |
| IUPAC Name | [5-fluoro-2-[(4-fluorophenyl)methoxy]pyrimidin-4-yl]oxyphosphonamidic acid |
| SMILES | NP(=O)(O)Oc1nc(OCc2ccc(F)cc2)ncc1F |
| InChI | InChI=1S/C11H10F2N3O4P/c12-8-3-1-7(2-4-8)6-19-11-15-5-9(13)10(16-11)20-21(14,17)18/h1-5H,6H2,(H3,14,17,18) |
| InChIKey | MWBZEXQBTMRWFE-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 107.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.19 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|