C15H13F2N3O3 — CID 118311806
prop-1-en-2-yl N-[5-fluoro-2-[(4-fluorophenyl)methoxy]pyrimidin-4-yl]carbamate (PubChem CID 118311806) has the molecular formula C15H13F2N3O3 and a molecular weight of 321.28 g/mol. Its IUPAC name is prop-1-en-2-yl N-[5-fluoro-2-[(4-fluorophenyl)methoxy]pyrimidin-4-yl]carbamate.
| Compound Name | prop-1-en-2-yl N-[5-fluoro-2-[(4-fluorophenyl)methoxy]pyrimidin-4-yl]carbamate |
|---|---|
| PubChem CID | 118311806 |
| Molecular Formula | C15H13F2N3O3 |
| Molecular Weight | 321.28 g/mol |
| Exact Mass | 321.09 |
| IUPAC Name | prop-1-en-2-yl N-[5-fluoro-2-[(4-fluorophenyl)methoxy]pyrimidin-4-yl]carbamate |
| SMILES | C=C(C)OC(=O)Nc1nc(OCc2ccc(F)cc2)ncc1F |
| InChI | InChI=1S/C15H13F2N3O3/c1-9(2)23-15(21)20-13-12(17)7-18-14(19-13)22-8-10-3-5-11(16)6-4-10/h3-7H,1,8H2,2H3,(H,18,19,20,21) |
| InChIKey | GZMIYRLMYSNUKY-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.28 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|