C19H16F2N4O — CID 118312671
5-fluoro-2-[(4-fluorophenyl)methoxy]-N-[(E)-(2-methylphenyl)methylideneamino]pyrimidin-4-amine (PubChem CID 118312671) has the molecular formula C19H16F2N4O and a molecular weight of 354.36 g/mol. Its IUPAC name is 5-fluoro-2-[(4-fluorophenyl)methoxy]-N-[(E)-(2-methylphenyl)methylideneamino]pyrimidin-4-amine.
| Compound Name | 5-fluoro-2-[(4-fluorophenyl)methoxy]-N-[(E)-(2-methylphenyl)methylideneamino]pyrimidin-4-amine |
|---|---|
| PubChem CID | 118312671 |
| Molecular Formula | C19H16F2N4O |
| Molecular Weight | 354.36 g/mol |
| Exact Mass | 354.13 |
| IUPAC Name | 5-fluoro-2-[(4-fluorophenyl)methoxy]-N-[(E)-(2-methylphenyl)methylideneamino]pyrimidin-4-amine |
| SMILES | Cc1ccccc1/C=N/Nc1nc(OCc2ccc(F)cc2)ncc1F |
| InChI | InChI=1S/C19H16F2N4O/c1-13-4-2-3-5-15(13)10-23-25-18-17(21)11-22-19(24-18)26-12-14-6-8-16(20)9-7-14/h2-11H,12H2,1H3,(H,22,24,25)/b23-10+ |
| InChIKey | PHBHQKFNDMTLGI-AUEPDCJTSA-N |
| XLogP | 4.09 |
| TPSA | 59.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.36 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|