C17H13F3N4O — CID 59160653
1-[5-fluoro-2-[(4-fluorophenyl)methoxy]pyrimidin-4-yl]-2-(2-fluorophenyl)hydrazine (PubChem CID 59160653) has the molecular formula C17H13F3N4O and a molecular weight of 346.31 g/mol. Its IUPAC name is 1-[5-fluoro-2-[(4-fluorophenyl)methoxy]pyrimidin-4-yl]-2-(2-fluorophenyl)hydrazine.
| Compound Name | 1-[5-fluoro-2-[(4-fluorophenyl)methoxy]pyrimidin-4-yl]-2-(2-fluorophenyl)hydrazine |
|---|---|
| PubChem CID | 59160653 |
| Molecular Formula | C17H13F3N4O |
| Molecular Weight | 346.31 g/mol |
| Exact Mass | 346.10 |
| IUPAC Name | 1-[5-fluoro-2-[(4-fluorophenyl)methoxy]pyrimidin-4-yl]-2-(2-fluorophenyl)hydrazine |
| SMILES | Fc1ccc(COc2ncc(F)c(NNc3ccccc3F)n2)cc1 |
| InChI | InChI=1S/C17H13F3N4O/c18-12-7-5-11(6-8-12)10-25-17-21-9-14(20)16(22-17)24-23-15-4-2-1-3-13(15)19/h1-9,23H,10H2,(H,21,22,24) |
| InChIKey | OHIKXZAYHLGBDY-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 59.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.31 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|