C14H14FN3O2 — CID 59160652
5-fluoro-N-phenylmethoxy-2-prop-2-enoxypyrimidin-4-amine (PubChem CID 59160652) has the molecular formula C14H14FN3O2 and a molecular weight of 275.28 g/mol. Its IUPAC name is 5-fluoro-N-phenylmethoxy-2-prop-2-enoxypyrimidin-4-amine.
| Compound Name | 5-fluoro-N-phenylmethoxy-2-prop-2-enoxypyrimidin-4-amine |
|---|---|
| PubChem CID | 59160652 |
| Molecular Formula | C14H14FN3O2 |
| Molecular Weight | 275.28 g/mol |
| Exact Mass | 275.11 |
| IUPAC Name | 5-fluoro-N-phenylmethoxy-2-prop-2-enoxypyrimidin-4-amine |
| SMILES | C=CCOc1ncc(F)c(NOCc2ccccc2)n1 |
| InChI | InChI=1S/C14H14FN3O2/c1-2-8-19-14-16-9-12(15)13(17-14)18-20-10-11-6-4-3-5-7-11/h2-7,9H,1,8,10H2,(H,16,17,18) |
| InChIKey | PFRGIBVPQQZJMH-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.28 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|