C9H9FN4OS — CID 118312298
[5-fluoro-2-(thiophen-3-ylmethoxy)pyrimidin-4-yl]hydrazine (PubChem CID 118312298) has the molecular formula C9H9FN4OS and a molecular weight of 240.26 g/mol. Its IUPAC name is [5-fluoro-2-(thiophen-3-ylmethoxy)pyrimidin-4-yl]hydrazine.
| Compound Name | [5-fluoro-2-(thiophen-3-ylmethoxy)pyrimidin-4-yl]hydrazine |
|---|---|
| PubChem CID | 118312298 |
| Molecular Formula | C9H9FN4OS |
| Molecular Weight | 240.26 g/mol |
| Exact Mass | 240.05 |
| IUPAC Name | [5-fluoro-2-(thiophen-3-ylmethoxy)pyrimidin-4-yl]hydrazine |
| SMILES | NNc1nc(OCc2ccsc2)ncc1F |
| InChI | InChI=1S/C9H9FN4OS/c10-7-3-12-9(13-8(7)14-11)15-4-6-1-2-16-5-6/h1-3,5H,4,11H2,(H,12,13,14) |
| InChIKey | HWFXZIDLTPQGAK-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.26 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|