C19H17F2IN4O — CID 89165338
1-[5-fluoro-2-[(4-fluorophenyl)methoxy]pyrimidin-4-yl]-1-[[2-(iodomethyl)phenyl]methyl]hydrazine (PubChem CID 89165338) has the molecular formula C19H17F2IN4O and a molecular weight of 482.27 g/mol. Its IUPAC name is 1-[5-fluoro-2-[(4-fluorophenyl)methoxy]pyrimidin-4-yl]-1-[[2-(iodomethyl)phenyl]methyl]hydrazine.
| Compound Name | 1-[5-fluoro-2-[(4-fluorophenyl)methoxy]pyrimidin-4-yl]-1-[[2-(iodomethyl)phenyl]methyl]hydrazine |
|---|---|
| PubChem CID | 89165338 |
| Molecular Formula | C19H17F2IN4O |
| Molecular Weight | 482.27 g/mol |
| Exact Mass | 482.04 |
| IUPAC Name | 1-[5-fluoro-2-[(4-fluorophenyl)methoxy]pyrimidin-4-yl]-1-[[2-(iodomethyl)phenyl]methyl]hydrazine |
| SMILES | NN(Cc1ccccc1CI)c1nc(OCc2ccc(F)cc2)ncc1F |
| InChI | InChI=1S/C19H17F2IN4O/c20-16-7-5-13(6-8-16)12-27-19-24-10-17(21)18(25-19)26(23)11-15-4-2-1-3-14(15)9-22/h1-8,10H,9,11-12,23H2 |
| InChIKey | VOJSHCCNAVBCBI-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 64.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.27 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|