C18H14F4N2O2S — CID 18463709
5-(4-fluorophenyl)-1-methyl-4-(4-methylsulfonylphenyl)-2-(trifluoromethyl)imidazole (PubChem CID 18463709) has the molecular formula C18H14F4N2O2S and a molecular weight of 398.38 g/mol. Its IUPAC name is 5-(4-fluorophenyl)-1-methyl-4-(4-methylsulfonylphenyl)-2-(trifluoromethyl)imidazole.
| Compound Name | 5-(4-fluorophenyl)-1-methyl-4-(4-methylsulfonylphenyl)-2-(trifluoromethyl)imidazole |
|---|---|
| PubChem CID | 18463709 |
| Molecular Formula | C18H14F4N2O2S |
| Molecular Weight | 398.38 g/mol |
| Exact Mass | 398.07 |
| IUPAC Name | 5-(4-fluorophenyl)-1-methyl-4-(4-methylsulfonylphenyl)-2-(trifluoromethyl)imidazole |
| SMILES | Cn1c(C(F)(F)F)nc(-c2ccc(S(C)(=O)=O)cc2)c1-c1ccc(F)cc1 |
| InChI | InChI=1S/C18H14F4N2O2S/c1-24-16(12-3-7-13(19)8-4-12)15(23-17(24)18(20,21)22)11-5-9-14(10-6-11)27(2,25)26/h3-10H,1-2H3 |
| InChIKey | JJULJOXOPVPSNF-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.38 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |