C24H22FN3O2S — CID 18771516
4-[5-(4-fluorophenyl)-2-(4-methylsulfonylphenyl)-3-propylimidazol-4-yl]pyridine (PubChem CID 18771516) has the molecular formula C24H22FN3O2S and a molecular weight of 435.52 g/mol. Its IUPAC name is 4-[5-(4-fluorophenyl)-2-(4-methylsulfonylphenyl)-3-propylimidazol-4-yl]pyridine.
| Compound Name | 4-[5-(4-fluorophenyl)-2-(4-methylsulfonylphenyl)-3-propylimidazol-4-yl]pyridine |
|---|---|
| PubChem CID | 18771516 |
| Molecular Formula | C24H22FN3O2S |
| Molecular Weight | 435.52 g/mol |
| Exact Mass | 435.14 |
| IUPAC Name | 4-[5-(4-fluorophenyl)-2-(4-methylsulfonylphenyl)-3-propylimidazol-4-yl]pyridine |
| SMILES | CCCn1c(-c2ccc(S(C)(=O)=O)cc2)nc(-c2ccc(F)cc2)c1-c1ccncc1 |
| InChI | InChI=1S/C24H22FN3O2S/c1-3-16-28-23(18-12-14-26-15-13-18)22(17-4-8-20(25)9-5-17)27-24(28)19-6-10-21(11-7-19)31(2,29)30/h4-15H,3,16H2,1-2H3 |
| InChIKey | UXLXVJWHCPKXMJ-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 64.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.52 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |