C28H27FN4 — CID 20644660
4-[5-(4-fluorophenyl)-2-pent-1-ynyl-3-(4-pyridin-4-ylbutyl)imidazol-4-yl]pyridine (PubChem CID 20644660) has the molecular formula C28H27FN4 and a molecular weight of 438.55 g/mol. Its IUPAC name is 4-[5-(4-fluorophenyl)-2-pent-1-ynyl-3-(4-pyridin-4-ylbutyl)imidazol-4-yl]pyridine.
| Compound Name | 4-[5-(4-fluorophenyl)-2-pent-1-ynyl-3-(4-pyridin-4-ylbutyl)imidazol-4-yl]pyridine |
|---|---|
| PubChem CID | 20644660 |
| Molecular Formula | C28H27FN4 |
| Molecular Weight | 438.55 g/mol |
| Exact Mass | 438.22 |
| IUPAC Name | 4-[5-(4-fluorophenyl)-2-pent-1-ynyl-3-(4-pyridin-4-ylbutyl)imidazol-4-yl]pyridine |
| SMILES | CCCC#Cc1nc(-c2ccc(F)cc2)c(-c2ccncc2)n1CCCCc1ccncc1 |
| InChI | InChI=1S/C28H27FN4/c1-2-3-4-8-26-32-27(23-9-11-25(29)12-10-23)28(24-15-19-31-20-16-24)33(26)21-6-5-7-22-13-17-30-18-14-22/h9-20H,2-3,5-7,21H2,1H3 |
| InChIKey | LYLNHPLZFAKVNI-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.55 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|