C17H12F4NO2S2+ — CID 162541890
4-(4-fluorophenyl)-1-(4-methylsulfonylphenyl)-2-(trifluoromethyl)-1,3-thiazol-1-ium (PubChem CID 162541890) has the molecular formula C17H12F4NO2S2+ and a molecular weight of 402.41 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-1-(4-methylsulfonylphenyl)-2-(trifluoromethyl)-1,3-thiazol-1-ium.
| Compound Name | 4-(4-fluorophenyl)-1-(4-methylsulfonylphenyl)-2-(trifluoromethyl)-1,3-thiazol-1-ium |
|---|---|
| PubChem CID | 162541890 |
| Molecular Formula | C17H12F4NO2S2+ |
| Molecular Weight | 402.41 g/mol |
| Exact Mass | 402.02 |
| IUPAC Name | 4-(4-fluorophenyl)-1-(4-methylsulfonylphenyl)-2-(trifluoromethyl)-1,3-thiazol-1-ium |
| SMILES | CS(=O)(=O)c1ccc(-[s+]2cc(-c3ccc(F)cc3)nc2C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H12F4NO2S2/c1-26(23,24)14-8-6-13(7-9-14)25-10-15(22-16(25)17(19,20)21)11-2-4-12(18)5-3-11/h2-10H,1H3/q+1 |
| InChIKey | WZGSPYXLUSGFKI-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.41 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|