About 5-(4-fluorophenyl)-6-(4-methylsulfonylphenyl)-2-(trifluoromethyl)-1,4-dihydropyrimidine
5-(4-fluorophenyl)-6-(4-methylsulfonylphenyl)-2-(trifluoromethyl)-1,4-dihydropyrimidine (PubChem CID 173098337) has the molecular formula C18H14F4N2O2S
and a molecular weight of 398.38 g/mol. Its IUPAC name is 5-(4-fluorophenyl)-6-(4-methylsulfonylphenyl)-2-(trifluoromethyl)-1,4-dihydropyrimidine.
Molecular Properties
| Compound Name | 5-(4-fluorophenyl)-6-(4-methylsulfonylphenyl)-2-(trifluoromethyl)-1,4-dihydropyrimidine |
| PubChem CID | 173098337 |
| Molecular Formula | C18H14F4N2O2S |
| Molecular Weight | 398.38 g/mol |
| Exact Mass | 398.07 |
| IUPAC Name | 5-(4-fluorophenyl)-6-(4-methylsulfonylphenyl)-2-(trifluoromethyl)-1,4-dihydropyrimidine |
| SMILES | CS(=O)(=O)c1ccc(C2=C(c3ccc(F)cc3)CN=C(C(F)(F)F)N2)cc1 |
| InChI | InChI=1S/C18H14F4N2O2S/c1-27(25,26)14-8-4-12(5-9-14)16-15(11-2-6-13(19)7-3-11)10-23-17(24-16)18(20,21)22/h2-9H,10H2,1H3,(H,23,24) |
| InChIKey | QJPMEJLYSAUJRO-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 398.38 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 5-(4-fluorophenyl)-6-(4-methylsulfonylphenyl)-2-(trifluoromethyl)-1,4-dihydropyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-fluorophenyl)-6-(4-methylsulfonylphenyl)-2-(trifluoromethyl)-1,4-dihydropyrimidine?
The IUPAC name of 5-(4-fluorophenyl)-6-(4-methylsulfonylphenyl)-2-(trifluoromethyl)-1,4-dihydropyrimidine (CID 173098337) is 5-(4-fluorophenyl)-6-(4-methylsulfonylphenyl)-2-(trifluoromethyl)-1,4-dihydropyrimidine.
What is the SMILES notation for 5-(4-fluorophenyl)-6-(4-methylsulfonylphenyl)-2-(trifluoromethyl)-1,4-dihydropyrimidine?
The canonical SMILES for 5-(4-fluorophenyl)-6-(4-methylsulfonylphenyl)-2-(trifluoromethyl)-1,4-dihydropyrimidine is CS(=O)(=O)c1ccc(C2=C(c3ccc(F)cc3)CN=C(C(F)(F)F)N2)cc1.
What is the InChIKey of 5-(4-fluorophenyl)-6-(4-methylsulfonylphenyl)-2-(trifluoromethyl)-1,4-dihydropyrimidine?
The InChIKey is QJPMEJLYSAUJRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14F4N2O2S/c1-27(25,26)14-8-4-12(5-9-14)16-15(11-2-6-13(19)7-3-11)10-23-17(24-16)18(20,21)22/h2-9H,10H2,1H3,(H,23,24).
What are the key properties of 5-(4-fluorophenyl)-6-(4-methylsulfonylphenyl)-2-(trifluoromethyl)-1,4-dihydropyrimidine?
5-(4-fluorophenyl)-6-(4-methylsulfonylphenyl)-2-(trifluoromethyl)-1,4-dihydropyrimidine has a molecular weight of 398.38 g/mol, XLogP of 3.66, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-fluorophenyl)-6-(4-methylsulfonylphenyl)-2-(trifluoromethyl)-1,4-dihydropyrimidine is sourced from PubChem (CID 173098337), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).