C20H19F3O2S — CID 22917692
1-[4-methyl-2-(4-methylsulfonylphenyl)cyclopenten-1-yl]-4-(trifluoromethyl)benzene (PubChem CID 22917692) has the molecular formula C20H19F3O2S and a molecular weight of 380.43 g/mol. Its IUPAC name is 1-[4-methyl-2-(4-methylsulfonylphenyl)cyclopenten-1-yl]-4-(trifluoromethyl)benzene.
| Compound Name | 1-[4-methyl-2-(4-methylsulfonylphenyl)cyclopenten-1-yl]-4-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 22917692 |
| Molecular Formula | C20H19F3O2S |
| Molecular Weight | 380.43 g/mol |
| Exact Mass | 380.11 |
| IUPAC Name | 1-[4-methyl-2-(4-methylsulfonylphenyl)cyclopenten-1-yl]-4-(trifluoromethyl)benzene |
| SMILES | CC1CC(c2ccc(C(F)(F)F)cc2)=C(c2ccc(S(C)(=O)=O)cc2)C1 |
| InChI | InChI=1S/C20H19F3O2S/c1-13-11-18(14-3-7-16(8-4-14)20(21,22)23)19(12-13)15-5-9-17(10-6-15)26(2,24)25/h3-10,13H,11-12H2,1-2H3 |
| InChIKey | DDSLRGSIJJZFMK-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.43 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|