C19H18F3NO3S — CID 22917529
4-[4-(hydroxymethyl)-2-[4-(trifluoromethyl)phenyl]cyclopenten-1-yl]benzenesulfonamide (PubChem CID 22917529) has the molecular formula C19H18F3NO3S and a molecular weight of 397.42 g/mol. Its IUPAC name is 4-[4-(hydroxymethyl)-2-[4-(trifluoromethyl)phenyl]cyclopenten-1-yl]benzenesulfonamide.
| Compound Name | 4-[4-(hydroxymethyl)-2-[4-(trifluoromethyl)phenyl]cyclopenten-1-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 22917529 |
| Molecular Formula | C19H18F3NO3S |
| Molecular Weight | 397.42 g/mol |
| Exact Mass | 397.10 |
| IUPAC Name | 4-[4-(hydroxymethyl)-2-[4-(trifluoromethyl)phenyl]cyclopenten-1-yl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(C2=C(c3ccc(C(F)(F)F)cc3)CC(CO)C2)cc1 |
| InChI | InChI=1S/C19H18F3NO3S/c20-19(21,22)15-5-1-13(2-6-15)17-9-12(11-24)10-18(17)14-3-7-16(8-4-14)27(23,25)26/h1-8,12,24H,9-11H2,(H2,23,25,26) |
| InChIKey | ZOAYEUQDXFASQS-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.42 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|