C15H11F3N2O2S — CID 148861191
4-[6-(trifluoromethyl)-1H-isoindol-4-yl]benzenesulfonamide (PubChem CID 148861191) has the molecular formula C15H11F3N2O2S and a molecular weight of 340.33 g/mol. Its IUPAC name is 4-[6-(trifluoromethyl)-1H-isoindol-4-yl]benzenesulfonamide.
| Compound Name | 4-[6-(trifluoromethyl)-1H-isoindol-4-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 148861191 |
| Molecular Formula | C15H11F3N2O2S |
| Molecular Weight | 340.33 g/mol |
| Exact Mass | 340.05 |
| IUPAC Name | 4-[6-(trifluoromethyl)-1H-isoindol-4-yl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(-c2cc(C(F)(F)F)cc3c2C=NC3)cc1 |
| InChI | InChI=1S/C15H11F3N2O2S/c16-15(17,18)11-5-10-7-20-8-14(10)13(6-11)9-1-3-12(4-2-9)23(19,21)22/h1-6,8H,7H2,(H2,19,21,22) |
| InChIKey | OZJDBFMXJRLPIF-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 72.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.33 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |