C19H12ClF4NO2S — CID 16753763
4-[2-(4-chloro-3-fluorophenyl)-4-(trifluoromethyl)phenyl]benzenesulfonamide (PubChem CID 16753763) has the molecular formula C19H12ClF4NO2S and a molecular weight of 429.82 g/mol. Its IUPAC name is 4-[2-(4-chloro-3-fluorophenyl)-4-(trifluoromethyl)phenyl]benzenesulfonamide.
| Compound Name | 4-[2-(4-chloro-3-fluorophenyl)-4-(trifluoromethyl)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 16753763 |
| Molecular Formula | C19H12ClF4NO2S |
| Molecular Weight | 429.82 g/mol |
| Exact Mass | 429.02 |
| IUPAC Name | 4-[2-(4-chloro-3-fluorophenyl)-4-(trifluoromethyl)phenyl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(-c2ccc(C(F)(F)F)cc2-c2ccc(Cl)c(F)c2)cc1 |
| InChI | InChI=1S/C19H12ClF4NO2S/c20-17-8-3-12(9-18(17)21)16-10-13(19(22,23)24)4-7-15(16)11-1-5-14(6-2-11)28(25,26)27/h1-10H,(H2,25,26,27) |
| InChIKey | JAPJIEVESADENP-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.82 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |