C19H12F5NO2S2 — CID 91456943
2,6-difluoro-4-[3-sulfanyl-4-[4-(trifluoromethyl)phenyl]phenyl]benzenesulfonamide (PubChem CID 91456943) has the molecular formula C19H12F5NO2S2 and a molecular weight of 445.43 g/mol. Its IUPAC name is 2,6-difluoro-4-[3-sulfanyl-4-[4-(trifluoromethyl)phenyl]phenyl]benzenesulfonamide.
| Compound Name | 2,6-difluoro-4-[3-sulfanyl-4-[4-(trifluoromethyl)phenyl]phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 91456943 |
| Molecular Formula | C19H12F5NO2S2 |
| Molecular Weight | 445.43 g/mol |
| Exact Mass | 445.02 |
| IUPAC Name | 2,6-difluoro-4-[3-sulfanyl-4-[4-(trifluoromethyl)phenyl]phenyl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1c(F)cc(-c2ccc(-c3ccc(C(F)(F)F)cc3)c(S)c2)cc1F |
| InChI | InChI=1S/C19H12F5NO2S2/c20-15-7-12(8-16(21)18(15)29(25,26)27)11-3-6-14(17(28)9-11)10-1-4-13(5-2-10)19(22,23)24/h1-9,28H,(H2,25,26,27) |
| InChIKey | USOLZKSFVBPHHT-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.43 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|