C27H14F6O3 — CID 145313593
2,7-dihydroxy-3,6-bis[4-(trifluoromethyl)phenyl]fluoren-9-one (PubChem CID 145313593) has the molecular formula C27H14F6O3 and a molecular weight of 500.39 g/mol. Its IUPAC name is 2,7-dihydroxy-3,6-bis[4-(trifluoromethyl)phenyl]fluoren-9-one.
| Compound Name | 2,7-dihydroxy-3,6-bis[4-(trifluoromethyl)phenyl]fluoren-9-one |
|---|---|
| PubChem CID | 145313593 |
| Molecular Formula | C27H14F6O3 |
| Molecular Weight | 500.39 g/mol |
| Exact Mass | 500.08 |
| IUPAC Name | 2,7-dihydroxy-3,6-bis[4-(trifluoromethyl)phenyl]fluoren-9-one |
| SMILES | O=C1c2cc(O)c(-c3ccc(C(F)(F)F)cc3)cc2-c2cc(-c3ccc(C(F)(F)F)cc3)c(O)cc21 |
| InChI | InChI=1S/C27H14F6O3/c28-26(29,30)15-5-1-13(2-6-15)17-9-19-20-10-18(14-3-7-16(8-4-14)27(31,32)33)24(35)12-22(20)25(36)21(19)11-23(17)34/h1-12,34-35H |
| InChIKey | LXDAXHMVGGIYMA-UHFFFAOYSA-N |
| XLogP | 7.68 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.39 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |