C18H11Cl2F2NO2S2 — CID 91038311
4-[4-(3,5-dichlorophenyl)-3-sulfanylphenyl]-2,6-difluorobenzenesulfonamide (PubChem CID 91038311) has the molecular formula C18H11Cl2F2NO2S2 and a molecular weight of 446.33 g/mol. Its IUPAC name is 4-[4-(3,5-dichlorophenyl)-3-sulfanylphenyl]-2,6-difluorobenzenesulfonamide.
| Compound Name | 4-[4-(3,5-dichlorophenyl)-3-sulfanylphenyl]-2,6-difluorobenzenesulfonamide |
|---|---|
| PubChem CID | 91038311 |
| Molecular Formula | C18H11Cl2F2NO2S2 |
| Molecular Weight | 446.33 g/mol |
| Exact Mass | 444.96 |
| IUPAC Name | 4-[4-(3,5-dichlorophenyl)-3-sulfanylphenyl]-2,6-difluorobenzenesulfonamide |
| SMILES | NS(=O)(=O)c1c(F)cc(-c2ccc(-c3cc(Cl)cc(Cl)c3)c(S)c2)cc1F |
| InChI | InChI=1S/C18H11Cl2F2NO2S2/c19-12-3-11(4-13(20)8-12)14-2-1-9(7-17(14)26)10-5-15(21)18(16(22)6-10)27(23,24)25/h1-8,26H,(H2,23,24,25) |
| InChIKey | JDDRWFQRFVMXOG-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.33 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|