C16H11ClFNO2S2 — CID 139972120
4-[4-(4-chlorophenyl)thiophen-3-yl]-2-fluorobenzenesulfonamide (PubChem CID 139972120) has the molecular formula C16H11ClFNO2S2 and a molecular weight of 367.85 g/mol. Its IUPAC name is 4-[4-(4-chlorophenyl)thiophen-3-yl]-2-fluorobenzenesulfonamide.
| Compound Name | 4-[4-(4-chlorophenyl)thiophen-3-yl]-2-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 139972120 |
| Molecular Formula | C16H11ClFNO2S2 |
| Molecular Weight | 367.85 g/mol |
| Exact Mass | 366.99 |
| IUPAC Name | 4-[4-(4-chlorophenyl)thiophen-3-yl]-2-fluorobenzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(-c2cscc2-c2ccc(Cl)cc2)cc1F |
| InChI | InChI=1S/C16H11ClFNO2S2/c17-12-4-1-10(2-5-12)13-8-22-9-14(13)11-3-6-16(15(18)7-11)23(19,20)21/h1-9H,(H2,19,20,21) |
| InChIKey | HWKMTBSSHNKUEG-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.85 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |