C19H13F4NO2S2 — CID 91027770
2-fluoro-4-[3-sulfanyl-4-[4-(trifluoromethyl)phenyl]phenyl]benzenesulfonamide (PubChem CID 91027770) has the molecular formula C19H13F4NO2S2 and a molecular weight of 427.44 g/mol. Its IUPAC name is 2-fluoro-4-[3-sulfanyl-4-[4-(trifluoromethyl)phenyl]phenyl]benzenesulfonamide.
| Compound Name | 2-fluoro-4-[3-sulfanyl-4-[4-(trifluoromethyl)phenyl]phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 91027770 |
| Molecular Formula | C19H13F4NO2S2 |
| Molecular Weight | 427.44 g/mol |
| Exact Mass | 427.03 |
| IUPAC Name | 2-fluoro-4-[3-sulfanyl-4-[4-(trifluoromethyl)phenyl]phenyl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(-c2ccc(-c3ccc(C(F)(F)F)cc3)c(S)c2)cc1F |
| InChI | InChI=1S/C19H13F4NO2S2/c20-16-9-12(4-8-18(16)28(24,25)26)13-3-7-15(17(27)10-13)11-1-5-14(6-2-11)19(21,22)23/h1-10,27H,(H2,24,25,26) |
| InChIKey | KMGFUSZNFBNDJZ-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.44 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|