C18H13ClF2N2O2S — CID 22746744
4-[3-(4-chloro-3-methylphenyl)-2-pyridinyl]-2,6-difluorobenzenesulfonamide (PubChem CID 22746744) has the molecular formula C18H13ClF2N2O2S and a molecular weight of 394.83 g/mol. Its IUPAC name is 4-[3-(4-chloro-3-methylphenyl)-2-pyridinyl]-2,6-difluorobenzenesulfonamide.
| Compound Name | 4-[3-(4-chloro-3-methylphenyl)-2-pyridinyl]-2,6-difluorobenzenesulfonamide |
|---|---|
| PubChem CID | 22746744 |
| Molecular Formula | C18H13ClF2N2O2S |
| Molecular Weight | 394.83 g/mol |
| Exact Mass | 394.04 |
| IUPAC Name | 4-[3-(4-chloro-3-methylphenyl)-2-pyridinyl]-2,6-difluorobenzenesulfonamide |
| SMILES | Cc1cc(-c2cccnc2-c2cc(F)c(S(N)(=O)=O)c(F)c2)ccc1Cl |
| InChI | InChI=1S/C18H13ClF2N2O2S/c1-10-7-11(4-5-14(10)19)13-3-2-6-23-17(13)12-8-15(20)18(16(21)9-12)26(22,24)25/h2-9H,1H3,(H2,22,24,25) |
| InChIKey | VIEYKICNNHXPSY-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.83 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |