C22H18F3NO6S — CID 23370571
dimethyl 3-(4-sulfamoylphenyl)-4-[4-(trifluoromethyl)phenyl]cyclopenta-2,4-diene-1,1-dicarboxylate (PubChem CID 23370571) has the molecular formula C22H18F3NO6S and a molecular weight of 481.45 g/mol. Its IUPAC name is dimethyl 3-(4-sulfamoylphenyl)-4-[4-(trifluoromethyl)phenyl]cyclopenta-2,4-diene-1,1-dicarboxylate.
| Compound Name | dimethyl 3-(4-sulfamoylphenyl)-4-[4-(trifluoromethyl)phenyl]cyclopenta-2,4-diene-1,1-dicarboxylate |
|---|---|
| PubChem CID | 23370571 |
| Molecular Formula | C22H18F3NO6S |
| Molecular Weight | 481.45 g/mol |
| Exact Mass | 481.08 |
| IUPAC Name | dimethyl 3-(4-sulfamoylphenyl)-4-[4-(trifluoromethyl)phenyl]cyclopenta-2,4-diene-1,1-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)C=C(c2ccc(C(F)(F)F)cc2)C(c2ccc(S(N)(=O)=O)cc2)=C1 |
| InChI | InChI=1S/C22H18F3NO6S/c1-31-19(27)21(20(28)32-2)11-17(13-3-7-15(8-4-13)22(23,24)25)18(12-21)14-5-9-16(10-6-14)33(26,29)30/h3-12H,1-2H3,(H2,26,29,30) |
| InChIKey | HSEUPTAXKUKNQR-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 112.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.45 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|