C19H16F4O2S — CID 22917511
1-[4-fluoro-2-(4-methylsulfonylphenyl)cyclopenten-1-yl]-4-(trifluoromethyl)benzene (PubChem CID 22917511) has the molecular formula C19H16F4O2S and a molecular weight of 384.39 g/mol. Its IUPAC name is 1-[4-fluoro-2-(4-methylsulfonylphenyl)cyclopenten-1-yl]-4-(trifluoromethyl)benzene.
| Compound Name | 1-[4-fluoro-2-(4-methylsulfonylphenyl)cyclopenten-1-yl]-4-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 22917511 |
| Molecular Formula | C19H16F4O2S |
| Molecular Weight | 384.39 g/mol |
| Exact Mass | 384.08 |
| IUPAC Name | 1-[4-fluoro-2-(4-methylsulfonylphenyl)cyclopenten-1-yl]-4-(trifluoromethyl)benzene |
| SMILES | CS(=O)(=O)c1ccc(C2=C(c3ccc(C(F)(F)F)cc3)CC(F)C2)cc1 |
| InChI | InChI=1S/C19H16F4O2S/c1-26(24,25)16-8-4-13(5-9-16)18-11-15(20)10-17(18)12-2-6-14(7-3-12)19(21,22)23/h2-9,15H,10-11H2,1H3 |
| InChIKey | DPWXXJNUDZJUTL-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.39 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|