C20H19F3O4S — CID 19935679
[3-(4-methylsulfonylphenyl)-4-[4-(trifluoromethyl)phenyl]cyclopenten-1-yl]methanediol (PubChem CID 19935679) has the molecular formula C20H19F3O4S and a molecular weight of 412.43 g/mol. Its IUPAC name is [3-(4-methylsulfonylphenyl)-4-[4-(trifluoromethyl)phenyl]cyclopenten-1-yl]methanediol.
| Compound Name | [3-(4-methylsulfonylphenyl)-4-[4-(trifluoromethyl)phenyl]cyclopenten-1-yl]methanediol |
|---|---|
| PubChem CID | 19935679 |
| Molecular Formula | C20H19F3O4S |
| Molecular Weight | 412.43 g/mol |
| Exact Mass | 412.10 |
| IUPAC Name | [3-(4-methylsulfonylphenyl)-4-[4-(trifluoromethyl)phenyl]cyclopenten-1-yl]methanediol |
| SMILES | CS(=O)(=O)c1ccc(C2C=C(C(O)O)CC2c2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C20H19F3O4S/c1-28(26,27)16-8-4-13(5-9-16)18-11-14(19(24)25)10-17(18)12-2-6-15(7-3-12)20(21,22)23/h2-9,11,17-19,24-25H,10H2,1H3 |
| InChIKey | CXJTWDIXUAWMBB-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.43 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|