C17H14FN3O4S2 — CID 8523305
4-fluoro-N-[4-(6-methylsulfonylpyridazin-3-yl)phenyl]benzenesulfonamide (PubChem CID 8523305) has the molecular formula C17H14FN3O4S2 and a molecular weight of 407.45 g/mol. Its IUPAC name is 4-fluoro-N-[4-(6-methylsulfonylpyridazin-3-yl)phenyl]benzenesulfonamide.
| Compound Name | 4-fluoro-N-[4-(6-methylsulfonylpyridazin-3-yl)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 8523305 |
| Molecular Formula | C17H14FN3O4S2 |
| Molecular Weight | 407.45 g/mol |
| Exact Mass | 407.04 |
| IUPAC Name | 4-fluoro-N-[4-(6-methylsulfonylpyridazin-3-yl)phenyl]benzenesulfonamide |
| SMILES | CS(=O)(=O)c1ccc(-c2ccc(NS(=O)(=O)c3ccc(F)cc3)cc2)nn1 |
| InChI | InChI=1S/C17H14FN3O4S2/c1-26(22,23)17-11-10-16(19-20-17)12-2-6-14(7-3-12)21-27(24,25)15-8-4-13(18)5-9-15/h2-11,21H,1H3 |
| InChIKey | GFHUSHXONZLSSR-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 106.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.45 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |