C16H15N3O4S3 — CID 8523310
5-methyl-N-[4-(6-methylsulfonylpyridazin-3-yl)phenyl]thiophene-2-sulfonamide (PubChem CID 8523310) has the molecular formula C16H15N3O4S3 and a molecular weight of 409.51 g/mol. Its IUPAC name is 5-methyl-N-[4-(6-methylsulfonylpyridazin-3-yl)phenyl]thiophene-2-sulfonamide.
| Compound Name | 5-methyl-N-[4-(6-methylsulfonylpyridazin-3-yl)phenyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 8523310 |
| Molecular Formula | C16H15N3O4S3 |
| Molecular Weight | 409.51 g/mol |
| Exact Mass | 409.02 |
| IUPAC Name | 5-methyl-N-[4-(6-methylsulfonylpyridazin-3-yl)phenyl]thiophene-2-sulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2ccc(-c3ccc(S(C)(=O)=O)nn3)cc2)s1 |
| InChI | InChI=1S/C16H15N3O4S3/c1-11-3-10-16(24-11)26(22,23)19-13-6-4-12(5-7-13)14-8-9-15(18-17-14)25(2,20)21/h3-10,19H,1-2H3 |
| InChIKey | SHDKOUGGLUUGIS-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 106.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.51 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |