C17H16N2O2S2 — CID 167542082
2-(4-methylsulfonylphenyl)-6-(2-thiophen-2-ylethyl)pyrazine (PubChem CID 167542082) has the molecular formula C17H16N2O2S2 and a molecular weight of 344.46 g/mol. Its IUPAC name is 2-(4-methylsulfonylphenyl)-6-(2-thiophen-2-ylethyl)pyrazine.
| Compound Name | 2-(4-methylsulfonylphenyl)-6-(2-thiophen-2-ylethyl)pyrazine |
|---|---|
| PubChem CID | 167542082 |
| Molecular Formula | C17H16N2O2S2 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.07 |
| IUPAC Name | 2-(4-methylsulfonylphenyl)-6-(2-thiophen-2-ylethyl)pyrazine |
| SMILES | CS(=O)(=O)c1ccc(-c2cncc(CCc3cccs3)n2)cc1 |
| InChI | InChI=1S/C17H16N2O2S2/c1-23(20,21)16-8-4-13(5-9-16)17-12-18-11-14(19-17)6-7-15-3-2-10-22-15/h2-5,8-12H,6-7H2,1H3 |
| InChIKey | QBXUGOOMCBLHPS-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 59.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |