C19H20N2O3S2 — CID 167581803
3-(methoxymethyl)-6-(4-methylsulfonylphenyl)-N-(thiophen-2-ylmethyl)pyridin-2-amine (PubChem CID 167581803) has the molecular formula C19H20N2O3S2 and a molecular weight of 388.51 g/mol. Its IUPAC name is 3-(methoxymethyl)-6-(4-methylsulfonylphenyl)-N-(thiophen-2-ylmethyl)pyridin-2-amine.
| Compound Name | 3-(methoxymethyl)-6-(4-methylsulfonylphenyl)-N-(thiophen-2-ylmethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 167581803 |
| Molecular Formula | C19H20N2O3S2 |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.09 |
| IUPAC Name | 3-(methoxymethyl)-6-(4-methylsulfonylphenyl)-N-(thiophen-2-ylmethyl)pyridin-2-amine |
| SMILES | COCc1ccc(-c2ccc(S(C)(=O)=O)cc2)nc1NCc1cccs1 |
| InChI | InChI=1S/C19H20N2O3S2/c1-24-13-15-7-10-18(14-5-8-17(9-6-14)26(2,22)23)21-19(15)20-12-16-4-3-11-25-16/h3-11H,12-13H2,1-2H3,(H,20,21) |
| InChIKey | CDQFDFQZAJHGBE-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |