C13H14N4O3S — CID 91026645
3-(aminomethyl)-6-(4-methylsulfonylphenyl)pyrazine-2-carboxamide (PubChem CID 91026645) has the molecular formula C13H14N4O3S and a molecular weight of 306.35 g/mol. Its IUPAC name is 3-(aminomethyl)-6-(4-methylsulfonylphenyl)pyrazine-2-carboxamide.
| Compound Name | 3-(aminomethyl)-6-(4-methylsulfonylphenyl)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 91026645 |
| Molecular Formula | C13H14N4O3S |
| Molecular Weight | 306.35 g/mol |
| Exact Mass | 306.08 |
| IUPAC Name | 3-(aminomethyl)-6-(4-methylsulfonylphenyl)pyrazine-2-carboxamide |
| SMILES | CS(=O)(=O)c1ccc(-c2cnc(CN)c(C(N)=O)n2)cc1 |
| InChI | InChI=1S/C13H14N4O3S/c1-21(19,20)9-4-2-8(3-5-9)11-7-16-10(6-14)12(17-11)13(15)18/h2-5,7H,6,14H2,1H3,(H2,15,18) |
| InChIKey | FXIOJVFMFGFWDC-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 129.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.35 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |