C19H19N4O8PS2 — CID 166681364
[4-[[3-amino-6-(4-methylsulfonylphenyl)pyrazine-2-carbonyl]amino]phenyl]sulfonylmethylphosphonic acid (PubChem CID 166681364) has the molecular formula C19H19N4O8PS2 and a molecular weight of 526.49 g/mol. Its IUPAC name is [4-[[3-amino-6-(4-methylsulfonylphenyl)pyrazine-2-carbonyl]amino]phenyl]sulfonylmethylphosphonic acid.
| Compound Name | [4-[[3-amino-6-(4-methylsulfonylphenyl)pyrazine-2-carbonyl]amino]phenyl]sulfonylmethylphosphonic acid |
|---|---|
| PubChem CID | 166681364 |
| Molecular Formula | C19H19N4O8PS2 |
| Molecular Weight | 526.49 g/mol |
| Exact Mass | 526.04 |
| IUPAC Name | [4-[[3-amino-6-(4-methylsulfonylphenyl)pyrazine-2-carbonyl]amino]phenyl]sulfonylmethylphosphonic acid |
| SMILES | CS(=O)(=O)c1ccc(-c2cnc(N)c(C(=O)Nc3ccc(S(=O)(=O)CP(=O)(O)O)cc3)n2)cc1 |
| InChI | InChI=1S/C19H19N4O8PS2/c1-33(28,29)14-6-2-12(3-7-14)16-10-21-18(20)17(23-16)19(24)22-13-4-8-15(9-5-13)34(30,31)11-32(25,26)27/h2-10H,11H2,1H3,(H2,20,21)(H,22,24)(H2,25,26,27) |
| InChIKey | NEPYUZUNIFFRKQ-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 206.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.49 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|