C18H16FN4O6PS — CID 166681391
[4-[[3-amino-6-(4-fluorophenyl)pyrazine-2-carbonyl]amino]phenyl]sulfonylmethylphosphonic acid (PubChem CID 166681391) has the molecular formula C18H16FN4O6PS and a molecular weight of 466.39 g/mol. Its IUPAC name is [4-[[3-amino-6-(4-fluorophenyl)pyrazine-2-carbonyl]amino]phenyl]sulfonylmethylphosphonic acid.
| Compound Name | [4-[[3-amino-6-(4-fluorophenyl)pyrazine-2-carbonyl]amino]phenyl]sulfonylmethylphosphonic acid |
|---|---|
| PubChem CID | 166681391 |
| Molecular Formula | C18H16FN4O6PS |
| Molecular Weight | 466.39 g/mol |
| Exact Mass | 466.05 |
| IUPAC Name | [4-[[3-amino-6-(4-fluorophenyl)pyrazine-2-carbonyl]amino]phenyl]sulfonylmethylphosphonic acid |
| SMILES | Nc1ncc(-c2ccc(F)cc2)nc1C(=O)Nc1ccc(S(=O)(=O)CP(=O)(O)O)cc1 |
| InChI | InChI=1S/C18H16FN4O6PS/c19-12-3-1-11(2-4-12)15-9-21-17(20)16(23-15)18(24)22-13-5-7-14(8-6-13)31(28,29)10-30(25,26)27/h1-9H,10H2,(H2,20,21)(H,22,24)(H2,25,26,27) |
| InChIKey | SDBWIAMNBZDBEW-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 172.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.39 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|