C22H25N4O6PS — CID 156816986
3-amino-N-[4-(dimethoxyphosphorylmethylsulfonyl)phenyl]-6-(2,4-dimethylphenyl)pyrazine-2-carboxamide (PubChem CID 156816986) has the molecular formula C22H25N4O6PS and a molecular weight of 504.51 g/mol. Its IUPAC name is 3-amino-N-[4-(dimethoxyphosphorylmethylsulfonyl)phenyl]-6-(2,4-dimethylphenyl)pyrazine-2-carboxamide.
| Compound Name | 3-amino-N-[4-(dimethoxyphosphorylmethylsulfonyl)phenyl]-6-(2,4-dimethylphenyl)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 156816986 |
| Molecular Formula | C22H25N4O6PS |
| Molecular Weight | 504.51 g/mol |
| Exact Mass | 504.12 |
| IUPAC Name | 3-amino-N-[4-(dimethoxyphosphorylmethylsulfonyl)phenyl]-6-(2,4-dimethylphenyl)pyrazine-2-carboxamide |
| SMILES | COP(=O)(CS(=O)(=O)c1ccc(NC(=O)c2nc(-c3ccc(C)cc3C)cnc2N)cc1)OC |
| InChI | InChI=1S/C22H25N4O6PS/c1-14-5-10-18(15(2)11-14)19-12-24-21(23)20(26-19)22(27)25-16-6-8-17(9-7-16)34(29,30)13-33(28,31-3)32-4/h5-12H,13H2,1-4H3,(H2,23,24)(H,25,27) |
| InChIKey | ALFPOBPJCZRWSZ-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 150.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.51 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|