C21H20N4O4S — CID 159494311
3-amino-N-[4-(2-hydroxyprop-2-enylsulfonyl)phenyl]-6-(4-methylphenyl)pyrazine-2-carboxamide (PubChem CID 159494311) has the molecular formula C21H20N4O4S and a molecular weight of 424.48 g/mol. Its IUPAC name is 3-amino-N-[4-(2-hydroxyprop-2-enylsulfonyl)phenyl]-6-(4-methylphenyl)pyrazine-2-carboxamide.
| Compound Name | 3-amino-N-[4-(2-hydroxyprop-2-enylsulfonyl)phenyl]-6-(4-methylphenyl)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 159494311 |
| Molecular Formula | C21H20N4O4S |
| Molecular Weight | 424.48 g/mol |
| Exact Mass | 424.12 |
| IUPAC Name | 3-amino-N-[4-(2-hydroxyprop-2-enylsulfonyl)phenyl]-6-(4-methylphenyl)pyrazine-2-carboxamide |
| SMILES | C=C(O)CS(=O)(=O)c1ccc(NC(=O)c2nc(-c3ccc(C)cc3)cnc2N)cc1 |
| InChI | InChI=1S/C21H20N4O4S/c1-13-3-5-15(6-4-13)18-11-23-20(22)19(25-18)21(27)24-16-7-9-17(10-8-16)30(28,29)12-14(2)26/h3-11,26H,2,12H2,1H3,(H2,22,23)(H,24,27) |
| InChIKey | PIBLIFHDJFNWQY-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 135.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.48 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|