C22H22N4O3S — CID 156817291
ethyl 2-[4-[[3-amino-6-(4-methylphenyl)pyrazine-2-carbonyl]amino]phenyl]sulfanylacetate (PubChem CID 156817291) has the molecular formula C22H22N4O3S and a molecular weight of 422.51 g/mol. Its IUPAC name is ethyl 2-[4-[[3-amino-6-(4-methylphenyl)pyrazine-2-carbonyl]amino]phenyl]sulfanylacetate.
| Compound Name | ethyl 2-[4-[[3-amino-6-(4-methylphenyl)pyrazine-2-carbonyl]amino]phenyl]sulfanylacetate |
|---|---|
| PubChem CID | 156817291 |
| Molecular Formula | C22H22N4O3S |
| Molecular Weight | 422.51 g/mol |
| Exact Mass | 422.14 |
| IUPAC Name | ethyl 2-[4-[[3-amino-6-(4-methylphenyl)pyrazine-2-carbonyl]amino]phenyl]sulfanylacetate |
| SMILES | CCOC(=O)CSc1ccc(NC(=O)c2nc(-c3ccc(C)cc3)cnc2N)cc1 |
| InChI | InChI=1S/C22H22N4O3S/c1-3-29-19(27)13-30-17-10-8-16(9-11-17)25-22(28)20-21(23)24-12-18(26-20)15-6-4-14(2)5-7-15/h4-12H,3,13H2,1-2H3,(H2,23,24)(H,25,28) |
| InChIKey | YXLDZFVWYZPWQV-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 107.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.51 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |