C19H16ClN5O4S — CID 156816991
N-[4-(acetylsulfamoyl)phenyl]-3-amino-6-(4-chlorophenyl)pyrazine-2-carboxamide (PubChem CID 156816991) has the molecular formula C19H16ClN5O4S and a molecular weight of 445.89 g/mol. Its IUPAC name is N-[4-(acetylsulfamoyl)phenyl]-3-amino-6-(4-chlorophenyl)pyrazine-2-carboxamide.
| Compound Name | N-[4-(acetylsulfamoyl)phenyl]-3-amino-6-(4-chlorophenyl)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 156816991 |
| Molecular Formula | C19H16ClN5O4S |
| Molecular Weight | 445.89 g/mol |
| Exact Mass | 445.06 |
| IUPAC Name | N-[4-(acetylsulfamoyl)phenyl]-3-amino-6-(4-chlorophenyl)pyrazine-2-carboxamide |
| SMILES | CC(=O)NS(=O)(=O)c1ccc(NC(=O)c2nc(-c3ccc(Cl)cc3)cnc2N)cc1 |
| InChI | InChI=1S/C19H16ClN5O4S/c1-11(26)25-30(28,29)15-8-6-14(7-9-15)23-19(27)17-18(21)22-10-16(24-17)12-2-4-13(20)5-3-12/h2-10H,1H3,(H2,21,22)(H,23,27)(H,25,26) |
| InChIKey | KGASXAWEQKVTHI-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 144.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.89 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |