C18H17N4O6PS — CID 175401275
[4-[(3-amino-6-phenylpyrazine-2-carbonyl)amino]phenyl]sulfonyloxy-methylphosphinic acid (PubChem CID 175401275) has the molecular formula C18H17N4O6PS and a molecular weight of 448.40 g/mol. Its IUPAC name is [4-[(3-amino-6-phenylpyrazine-2-carbonyl)amino]phenyl]sulfonyloxy-methylphosphinic acid.
| Compound Name | [4-[(3-amino-6-phenylpyrazine-2-carbonyl)amino]phenyl]sulfonyloxy-methylphosphinic acid |
|---|---|
| PubChem CID | 175401275 |
| Molecular Formula | C18H17N4O6PS |
| Molecular Weight | 448.40 g/mol |
| Exact Mass | 448.06 |
| IUPAC Name | [4-[(3-amino-6-phenylpyrazine-2-carbonyl)amino]phenyl]sulfonyloxy-methylphosphinic acid |
| SMILES | CP(=O)(O)OS(=O)(=O)c1ccc(NC(=O)c2nc(-c3ccccc3)cnc2N)cc1 |
| InChI | InChI=1S/C18H17N4O6PS/c1-29(24,25)28-30(26,27)14-9-7-13(8-10-14)21-18(23)16-17(19)20-11-15(22-16)12-5-3-2-4-6-12/h2-11H,1H3,(H2,19,20)(H,21,23)(H,24,25) |
| InChIKey | HLLMOSVSGFPSPV-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 161.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.40 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|