C20H21N4O6PS — CID 175401281
[4-[[3-amino-6-(2,4-dimethylphenyl)pyrazine-2-carbonyl]amino]phenyl]sulfonyloxy-methylphosphinic acid (PubChem CID 175401281) has the molecular formula C20H21N4O6PS and a molecular weight of 476.45 g/mol. Its IUPAC name is [4-[[3-amino-6-(2,4-dimethylphenyl)pyrazine-2-carbonyl]amino]phenyl]sulfonyloxy-methylphosphinic acid.
| Compound Name | [4-[[3-amino-6-(2,4-dimethylphenyl)pyrazine-2-carbonyl]amino]phenyl]sulfonyloxy-methylphosphinic acid |
|---|---|
| PubChem CID | 175401281 |
| Molecular Formula | C20H21N4O6PS |
| Molecular Weight | 476.45 g/mol |
| Exact Mass | 476.09 |
| IUPAC Name | [4-[[3-amino-6-(2,4-dimethylphenyl)pyrazine-2-carbonyl]amino]phenyl]sulfonyloxy-methylphosphinic acid |
| SMILES | Cc1ccc(-c2cnc(N)c(C(=O)Nc3ccc(S(=O)(=O)OP(C)(=O)O)cc3)n2)c(C)c1 |
| InChI | InChI=1S/C20H21N4O6PS/c1-12-4-9-16(13(2)10-12)17-11-22-19(21)18(24-17)20(25)23-14-5-7-15(8-6-14)32(28,29)30-31(3,26)27/h4-11H,1-3H3,(H2,21,22)(H,23,25)(H,26,27) |
| InChIKey | OTLCYRKFRXHROB-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 161.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.45 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|