C21H21ClN3O6PS — CID 157187431
1-[3-amino-6-(4-chlorophenyl)pyrazin-2-yl]-2-[4-(dimethoxyphosphorylmethylsulfonyl)phenyl]ethanone (PubChem CID 157187431) has the molecular formula C21H21ClN3O6PS and a molecular weight of 509.91 g/mol. Its IUPAC name is 1-[3-amino-6-(4-chlorophenyl)pyrazin-2-yl]-2-[4-(dimethoxyphosphorylmethylsulfonyl)phenyl]ethanone.
| Compound Name | 1-[3-amino-6-(4-chlorophenyl)pyrazin-2-yl]-2-[4-(dimethoxyphosphorylmethylsulfonyl)phenyl]ethanone |
|---|---|
| PubChem CID | 157187431 |
| Molecular Formula | C21H21ClN3O6PS |
| Molecular Weight | 509.91 g/mol |
| Exact Mass | 509.06 |
| IUPAC Name | 1-[3-amino-6-(4-chlorophenyl)pyrazin-2-yl]-2-[4-(dimethoxyphosphorylmethylsulfonyl)phenyl]ethanone |
| SMILES | COP(=O)(CS(=O)(=O)c1ccc(CC(=O)c2nc(-c3ccc(Cl)cc3)cnc2N)cc1)OC |
| InChI | InChI=1S/C21H21ClN3O6PS/c1-30-32(27,31-2)13-33(28,29)17-9-3-14(4-10-17)11-19(26)20-21(23)24-12-18(25-20)15-5-7-16(22)8-6-15/h3-10,12H,11,13H2,1-2H3,(H2,23,24) |
| InChIKey | NCBMFCJGNFYGLQ-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 138.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.91 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|