C24H25F3N3O6PS — CID 157296566
1-[3-amino-6-[4-(trifluoromethyl)phenyl]pyrazin-2-yl]-2-[4-(diethoxyphosphorylmethylsulfonyl)phenyl]ethanone (PubChem CID 157296566) has the molecular formula C24H25F3N3O6PS and a molecular weight of 571.51 g/mol. Its IUPAC name is 1-[3-amino-6-[4-(trifluoromethyl)phenyl]pyrazin-2-yl]-2-[4-(diethoxyphosphorylmethylsulfonyl)phenyl]ethanone.
| Compound Name | 1-[3-amino-6-[4-(trifluoromethyl)phenyl]pyrazin-2-yl]-2-[4-(diethoxyphosphorylmethylsulfonyl)phenyl]ethanone |
|---|---|
| PubChem CID | 157296566 |
| Molecular Formula | C24H25F3N3O6PS |
| Molecular Weight | 571.51 g/mol |
| Exact Mass | 571.12 |
| IUPAC Name | 1-[3-amino-6-[4-(trifluoromethyl)phenyl]pyrazin-2-yl]-2-[4-(diethoxyphosphorylmethylsulfonyl)phenyl]ethanone |
| SMILES | CCOP(=O)(CS(=O)(=O)c1ccc(CC(=O)c2nc(-c3ccc(C(F)(F)F)cc3)cnc2N)cc1)OCC |
| InChI | InChI=1S/C24H25F3N3O6PS/c1-3-35-37(32,36-4-2)15-38(33,34)19-11-5-16(6-12-19)13-21(31)22-23(28)29-14-20(30-22)17-7-9-18(10-8-17)24(25,26)27/h5-12,14H,3-4,13,15H2,1-2H3,(H2,28,29) |
| InChIKey | RISWEBCBSGURAL-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 138.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.51 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|