C26H25N5O2 — CID 91502013
3-(aminomethyl)-6-[3-[[(4-phenoxyphenyl)methylamino]methyl]phenyl]pyrazine-2-carboxamide (PubChem CID 91502013) has the molecular formula C26H25N5O2 and a molecular weight of 439.52 g/mol. Its IUPAC name is 3-(aminomethyl)-6-[3-[[(4-phenoxyphenyl)methylamino]methyl]phenyl]pyrazine-2-carboxamide.
| Compound Name | 3-(aminomethyl)-6-[3-[[(4-phenoxyphenyl)methylamino]methyl]phenyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 91502013 |
| Molecular Formula | C26H25N5O2 |
| Molecular Weight | 439.52 g/mol |
| Exact Mass | 439.20 |
| IUPAC Name | 3-(aminomethyl)-6-[3-[[(4-phenoxyphenyl)methylamino]methyl]phenyl]pyrazine-2-carboxamide |
| SMILES | NCc1ncc(-c2cccc(CNCc3ccc(Oc4ccccc4)cc3)c2)nc1C(N)=O |
| InChI | InChI=1S/C26H25N5O2/c27-14-23-25(26(28)32)31-24(17-30-23)20-6-4-5-19(13-20)16-29-15-18-9-11-22(12-10-18)33-21-7-2-1-3-8-21/h1-13,17,29H,14-16,27H2,(H2,28,32) |
| InChIKey | ZSUIPTNRVNUQBP-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 116.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.52 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |