C20H20N4O2 — CID 91210304
3-(aminomethyl)-6-[3-(2-phenylethoxy)phenyl]pyrazine-2-carboxamide (PubChem CID 91210304) has the molecular formula C20H20N4O2 and a molecular weight of 348.41 g/mol. Its IUPAC name is 3-(aminomethyl)-6-[3-(2-phenylethoxy)phenyl]pyrazine-2-carboxamide.
| Compound Name | 3-(aminomethyl)-6-[3-(2-phenylethoxy)phenyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 91210304 |
| Molecular Formula | C20H20N4O2 |
| Molecular Weight | 348.41 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | 3-(aminomethyl)-6-[3-(2-phenylethoxy)phenyl]pyrazine-2-carboxamide |
| SMILES | NCc1ncc(-c2cccc(OCCc3ccccc3)c2)nc1C(N)=O |
| InChI | InChI=1S/C20H20N4O2/c21-12-17-19(20(22)25)24-18(13-23-17)15-7-4-8-16(11-15)26-10-9-14-5-2-1-3-6-14/h1-8,11,13H,9-10,12,21H2,(H2,22,25) |
| InChIKey | OFSCBZKTGGJACR-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 104.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.41 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |