C12H12N2O4S2 — CID 115423211
methyl 2-(4-methylsulfonylanilino)-1,3-thiazole-4-carboxylate (PubChem CID 115423211) has the molecular formula C12H12N2O4S2 and a molecular weight of 312.37 g/mol. Its IUPAC name is methyl 2-(4-methylsulfonylanilino)-1,3-thiazole-4-carboxylate.
| Compound Name | methyl 2-(4-methylsulfonylanilino)-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 115423211 |
| Molecular Formula | C12H12N2O4S2 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.02 |
| IUPAC Name | methyl 2-(4-methylsulfonylanilino)-1,3-thiazole-4-carboxylate |
| SMILES | COC(=O)c1csc(Nc2ccc(S(C)(=O)=O)cc2)n1 |
| InChI | InChI=1S/C12H12N2O4S2/c1-18-11(15)10-7-19-12(14-10)13-8-3-5-9(6-4-8)20(2,16)17/h3-7H,1-2H3,(H,13,14) |
| InChIKey | MFYPPQBPLZENLX-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |