methyl 2-(2,6-difluoroanilino)-1,3-thiazole-4-carboxylate

C11H8F2N2O2S — CID 113306686

IUPACmethyl 2-(2,6-difluoroanilino)-1,3-thiazole-4-carboxylate
SMILESCOC(=O)c1csc(Nc2c(F)cccc2F)n1
InChIInChI=1S/C11H8F2N2O2S/c1-17-10(16)8-5-18-11(14-8)15-9-6(12)3-2-4-7(9)13/h2-5H,1H3,(H,14,15)
InChIKeyAOKPGBLWIRFNGB-UHFFFAOYSA-N
MW270.26 g/mol
LogP2.95
Rot. Bonds3

About methyl 2-(2,6-difluoroanilino)-1,3-thiazole-4-carboxylate

methyl 2-(2,6-difluoroanilino)-1,3-thiazole-4-carboxylate (PubChem CID 113306686) has the molecular formula C11H8F2N2O2S and a molecular weight of 270.26 g/mol. Its IUPAC name is methyl 2-(2,6-difluoroanilino)-1,3-thiazole-4-carboxylate.

Molecular Properties

Compound Namemethyl 2-(2,6-difluoroanilino)-1,3-thiazole-4-carboxylate
PubChem CID113306686
Molecular FormulaC11H8F2N2O2S
Molecular Weight270.26 g/mol
Exact Mass270.03
IUPAC Namemethyl 2-(2,6-difluoroanilino)-1,3-thiazole-4-carboxylate
SMILESCOC(=O)c1csc(Nc2c(F)cccc2F)n1
InChIInChI=1S/C11H8F2N2O2S/c1-17-10(16)8-5-18-11(14-8)15-9-6(12)3-2-4-7(9)13/h2-5H,1H3,(H,14,15)
InChIKeyAOKPGBLWIRFNGB-UHFFFAOYSA-N
XLogP2.95
TPSA51.22 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500270.26
LogP ≤ 52.95
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze methyl 2-(2,6-difluoroanilino)-1,3-thiazole-4-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-(2,6-difluoroanilino)-1,3-thiazole-4-carboxylate?
The IUPAC name of methyl 2-(2,6-difluoroanilino)-1,3-thiazole-4-carboxylate (CID 113306686) is methyl 2-(2,6-difluoroanilino)-1,3-thiazole-4-carboxylate.
What is the SMILES notation for methyl 2-(2,6-difluoroanilino)-1,3-thiazole-4-carboxylate?
The canonical SMILES for methyl 2-(2,6-difluoroanilino)-1,3-thiazole-4-carboxylate is COC(=O)c1csc(Nc2c(F)cccc2F)n1.
What is the InChIKey of methyl 2-(2,6-difluoroanilino)-1,3-thiazole-4-carboxylate?
The InChIKey is AOKPGBLWIRFNGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8F2N2O2S/c1-17-10(16)8-5-18-11(14-8)15-9-6(12)3-2-4-7(9)13/h2-5H,1H3,(H,14,15).
What are the key properties of methyl 2-(2,6-difluoroanilino)-1,3-thiazole-4-carboxylate?
methyl 2-(2,6-difluoroanilino)-1,3-thiazole-4-carboxylate has a molecular weight of 270.26 g/mol, XLogP of 2.95, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(2,6-difluoroanilino)-1,3-thiazole-4-carboxylate is sourced from PubChem (CID 113306686), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).