C17H11F2N3O3 — CID 52907899
2-benzamido-N-(3,4-difluorophenyl)-1,3-oxazole-4-carboxamide (PubChem CID 52907899) has the molecular formula C17H11F2N3O3 and a molecular weight of 343.29 g/mol. Its IUPAC name is 2-benzamido-N-(3,4-difluorophenyl)-1,3-oxazole-4-carboxamide.
| Compound Name | 2-benzamido-N-(3,4-difluorophenyl)-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 52907899 |
| Molecular Formula | C17H11F2N3O3 |
| Molecular Weight | 343.29 g/mol |
| Exact Mass | 343.08 |
| IUPAC Name | 2-benzamido-N-(3,4-difluorophenyl)-1,3-oxazole-4-carboxamide |
| SMILES | O=C(Nc1nc(C(=O)Nc2ccc(F)c(F)c2)co1)c1ccccc1 |
| InChI | InChI=1S/C17H11F2N3O3/c18-12-7-6-11(8-13(12)19)20-16(24)14-9-25-17(21-14)22-15(23)10-4-2-1-3-5-10/h1-9H,(H,20,24)(H,21,22,23) |
| InChIKey | SMYPEUOANHSNGE-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.29 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |